C29H32F3N2O+ — CID 101249444
4-[(R)-[(1S,2S,4S,5R)-5-ethyl-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline (PubChem CID 101249444) has the molecular formula C29H32F3N2O+ and a molecular weight of 481.58 g/mol. Its IUPAC name is 4-[(R)-[(1S,2S,4S,5R)-5-ethyl-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(1S,2S,4S,5R)-5-ethyl-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
|---|---|
| PubChem CID | 101249444 |
| Molecular Formula | C29H32F3N2O+ |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 4-[(R)-[(1S,2S,4S,5R)-5-ethyl-1-[(2,3,4-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
| SMILES | C=CCO[C@H](c1ccnc2ccccc12)[C@@H]1C[C@@H]2CC[N@@+]1(Cc1ccc(F)c(F)c1F)C[C@@H]2CC |
| InChI | InChI=1S/C29H32F3N2O/c1-3-15-35-29(23-11-13-33-25-8-6-5-7-22(23)25)26-16-20-12-14-34(26,17-19(20)4-2)18-21-9-10-24(30)28(32)27(21)31/h3,5-11,13,19-20,26,29H,1,4,12,14-18H2,2H3/q+1/t19-,20-,26-,29+,34-/m0/s1 |
| InChIKey | FHYMRKTXOAFUQZ-IRVODSDLSA-N |
| XLogP | 6.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|