C14H18O3 — CID 101221340
(1R,2R,5R,6S,8S)-2-methylspiro[12-oxatetracyclo[6.5.0.01,3.02,6]tridecane-5,2'-oxirane]-4-one (PubChem CID 101221340) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1R,2R,5R,6S,8S)-2-methylspiro[12-oxatetracyclo[6.5.0.01,3.02,6]tridecane-5,2'-oxirane]-4-one.
| Compound Name | (1R,2R,5R,6S,8S)-2-methylspiro[12-oxatetracyclo[6.5.0.01,3.02,6]tridecane-5,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 101221340 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1R,2R,5R,6S,8S)-2-methylspiro[12-oxatetracyclo[6.5.0.01,3.02,6]tridecane-5,2'-oxirane]-4-one |
| SMILES | C[C@]12C3C(=O)[C@]4(CO4)[C@H]1C[C@@H]1CCCOC[C@@]312 |
| InChI | InChI=1S/C14H18O3/c1-12-9-5-8-3-2-4-16-6-13(8,12)10(12)11(15)14(9)7-17-14/h8-10H,2-7H2,1H3/t8-,9-,10?,12+,13-,14-/m0/s1 |
| InChIKey | MLPSYJQLZXAPLN-DJZIHJHKSA-N |
| XLogP | 1.41 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|