C20H26O4 — CID 121444891
(1S,4S,7R,11R)-11-methylspiro[13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecane-5,2'-oxirane]-6,8-dione (PubChem CID 121444891) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1S,4S,7R,11R)-11-methylspiro[13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecane-5,2'-oxirane]-6,8-dione.
| Compound Name | (1S,4S,7R,11R)-11-methylspiro[13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecane-5,2'-oxirane]-6,8-dione |
|---|---|
| PubChem CID | 121444891 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1S,4S,7R,11R)-11-methylspiro[13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecane-5,2'-oxirane]-6,8-dione |
| SMILES | C[C@]12CCC[C@]3(COC1)C2CC(=O)[C@@]12CC[C@@H](CC13)C1(CO1)C2=O |
| InChI | InChI=1S/C20H26O4/c1-17-4-2-5-18(10-23-9-17)13(17)8-15(21)19-6-3-12(7-14(18)19)20(11-24-20)16(19)22/h12-14H,2-11H2,1H3/t12-,13?,14?,17-,18-,19+,20?/m0/s1 |
| InChIKey | GNPLDZLAHNSYQJ-WPBVKOJCSA-N |
| XLogP | 2.54 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|