C25H35NO6 — CID 121448217
[(1R,5R,9S,12S)-5-(hydroxymethyl)-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate (PubChem CID 121448217) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is [(1R,5R,9S,12S)-5-(hydroxymethyl)-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate.
| Compound Name | [(1R,5R,9S,12S)-5-(hydroxymethyl)-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 121448217 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [(1R,5R,9S,12S)-5-(hydroxymethyl)-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2[C@]1(COC(=O)N2CCOCC2)CCC[C@@](C)(CO)C1CC3=O |
| InChI | InChI=1S/C25H35NO6/c1-16-17-4-7-25(21(16)29)19(12-17)24(15-32-22(30)26-8-10-31-11-9-26)6-3-5-23(2,14-27)18(24)13-20(25)28/h17-19,27H,1,3-15H2,2H3/t17-,18?,19?,23-,24-,25+/m0/s1 |
| InChIKey | PXMMACOHPGGCGC-GMOJWYAASA-N |
| XLogP | 2.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|