C29H35NO4S — CID 123996097
[5-methyl-3,13,14-trimethylidene-2-oxo-5-(thiophene-2-carboximidoyloxymethyl)-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl acetate (PubChem CID 123996097) has the molecular formula C29H35NO4S and a molecular weight of 493.67 g/mol. Its IUPAC name is [5-methyl-3,13,14-trimethylidene-2-oxo-5-(thiophene-2-carboximidoyloxymethyl)-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl acetate.
| Compound Name | [5-methyl-3,13,14-trimethylidene-2-oxo-5-(thiophene-2-carboximidoyloxymethyl)-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl acetate |
|---|---|
| PubChem CID | 123996097 |
| Molecular Formula | C29H35NO4S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [5-methyl-3,13,14-trimethylidene-2-oxo-5-(thiophene-2-carboximidoyloxymethyl)-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl acetate |
| SMILES | [H]/N=C(/OCC1(C)CCCC2(COC(C)=O)C1C(=C)C(=O)C13CCC(CC12)C(=C)C3=C)c1cccs1 |
| InChI | InChI=1S/C29H35NO4S/c1-17-19(3)29-12-9-21(17)14-23(29)28(16-33-20(4)31)11-7-10-27(5,24(28)18(2)25(29)32)15-34-26(30)22-8-6-13-35-22/h6,8,13,21,23-24,30H,1-3,7,9-12,14-16H2,4-5H3/b30-26+ |
| InChIKey | JCQWJCMMWMVATM-URGPHPNLSA-N |
| XLogP | 6.11 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|