C31H34O5S2 — CID 160511017
[(1S,5R,9S,12S)-5-methyl-13,14-dimethylidene-2-oxo-9-(thiophene-2-carbonyloxymethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl thiophene-2-carboxylate (PubChem CID 160511017) has the molecular formula C31H34O5S2 and a molecular weight of 550.74 g/mol. Its IUPAC name is [(1S,5R,9S,12S)-5-methyl-13,14-dimethylidene-2-oxo-9-(thiophene-2-carbonyloxymethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl thiophene-2-carboxylate.
| Compound Name | [(1S,5R,9S,12S)-5-methyl-13,14-dimethylidene-2-oxo-9-(thiophene-2-carbonyloxymethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl thiophene-2-carboxylate |
|---|---|
| PubChem CID | 160511017 |
| Molecular Formula | C31H34O5S2 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [(1S,5R,9S,12S)-5-methyl-13,14-dimethylidene-2-oxo-9-(thiophene-2-carbonyloxymethyl)-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl thiophene-2-carboxylate |
| SMILES | C=C1C(=C)[C@]23CC[C@H]1CC2[C@]1(COC(=O)c2cccs2)CCC[C@@](C)(COC(=O)c2cccs2)C1CC3=O |
| InChI | InChI=1S/C31H34O5S2/c1-19-20(2)31-12-9-21(19)15-25(31)30(18-36-28(34)23-8-5-14-38-23)11-6-10-29(3,24(30)16-26(31)32)17-35-27(33)22-7-4-13-37-22/h4-5,7-8,13-14,21,24-25H,1-2,6,9-12,15-18H2,3H3/t21-,24?,25?,29-,30-,31+/m0/s1 |
| InChIKey | OGZVUHATWIIBKY-SHACSYFRSA-N |
| XLogP | 7.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |