C16H21NO3S — CID 126818614
N-(3-methoxyspiro[3.3]heptan-1-yl)-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 126818614) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is N-(3-methoxyspiro[3.3]heptan-1-yl)-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-(3-methoxyspiro[3.3]heptan-1-yl)-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 126818614 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(3-methoxyspiro[3.3]heptan-1-yl)-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | COC1CC(NC(=O)CCC(=O)c2cccs2)C12CCC2 |
| InChI | InChI=1S/C16H21NO3S/c1-20-14-10-13(16(14)7-3-8-16)17-15(19)6-5-11(18)12-4-2-9-21-12/h2,4,9,13-14H,3,5-8,10H2,1H3,(H,17,19) |
| InChIKey | JDZFRRCREKPNFF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |