C20H27NO2S — CID 26878730
N-[2-(1-adamantyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 26878730) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 26878730 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccs1)NCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27NO2S/c22-17(18-2-1-7-24-18)3-4-19(23)21-6-5-20-11-14-8-15(12-20)10-16(9-14)13-20/h1-2,7,14-16H,3-6,8-13H2,(H,21,23) |
| InChIKey | SPDLPFXVBCKMEB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |