C13H19ClN2O3S — CID 120944233
N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride (PubChem CID 120944233) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120944233 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxo-4-thiophen-2-ylbutanamide;hydrochloride |
| SMILES | Cl.O=C(CCC(=O)c1cccs1)NCC1CNCC1O |
| InChI | InChI=1S/C13H18N2O3S.ClH/c16-10(12-2-1-5-19-12)3-4-13(18)15-7-9-6-14-8-11(9)17;/h1-2,5,9,11,14,17H,3-4,6-8H2,(H,15,18);1H |
| InChIKey | UPSRZTVEKUTWLZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |