C19H28N2O3 — CID 120948573
N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide (PubChem CID 120948573) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 120948573 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-[4-(2-methylpropyl)phenyl]-4-oxobutanamide |
| SMILES | CC(C)Cc1ccc(C(=O)CCC(=O)NCC2CNCC2O)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-13(2)9-14-3-5-15(6-4-14)17(22)7-8-19(24)21-11-16-10-20-12-18(16)23/h3-6,13,16,18,20,23H,7-12H2,1-2H3,(H,21,24) |
| InChIKey | FTRSUNVSVPZRMV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |