C15H19ClN2O3 — CID 120945324
4-(4-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxobutanamide (PubChem CID 120945324) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 120945324 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)NCC1CNCC1O |
| InChI | InChI=1S/C15H19ClN2O3/c16-12-3-1-10(2-4-12)13(19)5-6-15(21)18-8-11-7-17-9-14(11)20/h1-4,11,14,17,20H,5-9H2,(H,18,21) |
| InChIKey | HNMYLUWIOLVJIF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |