C31H38O6S2 — CID 144732270
8,8-dimethyl-2-methylidenespiro[4a,4b,5,6,7,8a,9,10a-octahydro-4H-phenanthrene-3,1'-cyclopropane]-1,10-dione;bis(methyl thiophene-2-carboxylate) (PubChem CID 144732270) has the molecular formula C31H38O6S2 and a molecular weight of 570.77 g/mol. Its IUPAC name is 8,8-dimethyl-2-methylidenespiro[4a,4b,5,6,7,8a,9,10a-octahydro-4H-phenanthrene-3,1'-cyclopropane]-1,10-dione;bis(methyl thiophene-2-carboxylate).
| Compound Name | 8,8-dimethyl-2-methylidenespiro[4a,4b,5,6,7,8a,9,10a-octahydro-4H-phenanthrene-3,1'-cyclopropane]-1,10-dione;bis(methyl thiophene-2-carboxylate) |
|---|---|
| PubChem CID | 144732270 |
| Molecular Formula | C31H38O6S2 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 8,8-dimethyl-2-methylidenespiro[4a,4b,5,6,7,8a,9,10a-octahydro-4H-phenanthrene-3,1'-cyclopropane]-1,10-dione;bis(methyl thiophene-2-carboxylate) |
| SMILES | C=C1C(=O)C2C(=O)CC3C(CCCC3(C)C)C2CC12CC2.COC(=O)c1cccs1.COC(=O)c1cccs1 |
| InChI | InChI=1S/C19H26O2.2C6H6O2S/c1-11-17(21)16-13(10-19(11)7-8-19)12-5-4-6-18(2,3)14(12)9-15(16)20;2*1-8-6(7)5-3-2-4-9-5/h12-14,16H,1,4-10H2,2-3H3;2*2-4H,1H3 |
| InChIKey | LKFDDECGXFEYNH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|