C19H19Cl2NO3S — CID 59942316
[2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] thiophene-2-carboxylate (PubChem CID 59942316) has the molecular formula C19H19Cl2NO3S and a molecular weight of 412.34 g/mol. Its IUPAC name is [2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] thiophene-2-carboxylate.
| Compound Name | [2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59942316 |
| Molecular Formula | C19H19Cl2NO3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] thiophene-2-carboxylate |
| SMILES | CC1(C(=O)Nc2ccc(OC(=O)c3cccs3)c(Cl)c2Cl)CCCCC1 |
| InChI | InChI=1S/C19H19Cl2NO3S/c1-19(9-3-2-4-10-19)18(24)22-12-7-8-13(16(21)15(12)20)25-17(23)14-6-5-11-26-14/h5-8,11H,2-4,9-10H2,1H3,(H,22,24) |
| InChIKey | UCYFLKAODHHPKU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|