C23H20Cl3NO3S — CID 59942309
[2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 59942309) has the molecular formula C23H20Cl3NO3S and a molecular weight of 496.84 g/mol. Its IUPAC name is [2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 59942309 |
| Molecular Formula | C23H20Cl3NO3S |
| Molecular Weight | 496.84 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | [2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CC1(C(=O)Nc2ccc(OC(=O)c3sc4ccccc4c3Cl)c(Cl)c2Cl)CCCCC1 |
| InChI | InChI=1S/C23H20Cl3NO3S/c1-23(11-5-2-6-12-23)22(29)27-14-9-10-15(19(26)18(14)25)30-21(28)20-17(24)13-7-3-4-8-16(13)31-20/h3-4,7-10H,2,5-6,11-12H2,1H3,(H,27,29) |
| InChIKey | OCZZIOWKJNDKSR-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.84 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|