C18H24Cl2N2O4 — CID 59942319
methyl N-[[2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenoxy]methyl]-N-methylcarbamate (PubChem CID 59942319) has the molecular formula C18H24Cl2N2O4 and a molecular weight of 403.31 g/mol. Its IUPAC name is methyl N-[[2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenoxy]methyl]-N-methylcarbamate.
| Compound Name | methyl N-[[2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenoxy]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59942319 |
| Molecular Formula | C18H24Cl2N2O4 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | methyl N-[[2,3-dichloro-4-[(1-methylcyclohexanecarbonyl)amino]phenoxy]methyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)COc1ccc(NC(=O)C2(C)CCCCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H24Cl2N2O4/c1-18(9-5-4-6-10-18)16(23)21-12-7-8-13(15(20)14(12)19)26-11-22(2)17(24)25-3/h7-8H,4-6,9-11H2,1-3H3,(H,21,23) |
| InChIKey | WUFNVORIMMQGOR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|