C19H28ClNO3 — CID 100692486
N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-1-methylcyclopentane-1-carboxamide (PubChem CID 100692486) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-1-methylcyclopentane-1-carboxamide.
| Compound Name | N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-1-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100692486 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-1-methylcyclopentane-1-carboxamide |
| SMILES | COC(C)(C)CCOc1ccc(NC(=O)C2(C)CCCC2)cc1Cl |
| InChI | InChI=1S/C19H28ClNO3/c1-18(2,23-4)11-12-24-16-8-7-14(13-15(16)20)21-17(22)19(3)9-5-6-10-19/h7-8,13H,5-6,9-12H2,1-4H3,(H,21,22) |
| InChIKey | UMPRNWLZVXNRID-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |