C20H24Cl2N2O3 — CID 174612601
N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide;N-phenylhydroxylamine (PubChem CID 174612601) has the molecular formula C20H24Cl2N2O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide;N-phenylhydroxylamine.
| Compound Name | N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide;N-phenylhydroxylamine |
|---|---|
| PubChem CID | 174612601 |
| Molecular Formula | C20H24Cl2N2O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide;N-phenylhydroxylamine |
| SMILES | CC1(C(=O)Nc2ccc(O)c(Cl)c2Cl)CCCCC1.ONc1ccccc1 |
| InChI | InChI=1S/C14H17Cl2NO2.C6H7NO/c1-14(7-3-2-4-8-14)13(19)17-9-5-6-10(18)12(16)11(9)15;8-7-6-4-2-1-3-5-6/h5-6,18H,2-4,7-8H2,1H3,(H,17,19);1-5,7-8H |
| InChIKey | FJXRZGWQKVWLLC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|