C14H17Cl2NO2 — CID 71316720
2,2,3,3,4,4,5,5,6,6-decadeuterio-N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide (PubChem CID 71316720) has the molecular formula C14H17Cl2NO2 and a molecular weight of 312.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decadeuterio-N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71316720 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C(C)(C(=O)Nc2ccc(O)c(Cl)c2Cl)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C14H17Cl2NO2/c1-14(7-3-2-4-8-14)13(19)17-9-5-6-10(18)12(16)11(9)15/h5-6,18H,2-4,7-8H2,1H3,(H,17,19)/i2D2,3D2,4D2,7D2,8D2 |
| InChIKey | VDLGAVXLJYLFDH-CYHVTVHMSA-N |
| XLogP | 4.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|