C22H31NO2S — CID 22956219
S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 1-methylcyclohexane-1-carbothioate (PubChem CID 22956219) has the molecular formula C22H31NO2S and a molecular weight of 373.56 g/mol. Its IUPAC name is S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 1-methylcyclohexane-1-carbothioate.
| Compound Name | S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 1-methylcyclohexane-1-carbothioate |
|---|---|
| PubChem CID | 22956219 |
| Molecular Formula | C22H31NO2S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 1-methylcyclohexane-1-carbothioate |
| SMILES | CC1(C(=O)Nc2ccccc2SC(=O)C2(C)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C22H31NO2S/c1-21(13-7-3-8-14-21)19(24)23-17-11-5-6-12-18(17)26-20(25)22(2)15-9-4-10-16-22/h5-6,11-12H,3-4,7-10,13-16H2,1-2H3,(H,23,24) |
| InChIKey | IXTQIBBOKUEFRX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|