C25H31NO2S — CID 10364176
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzenecarbothioate (PubChem CID 10364176) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzenecarbothioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzenecarbothioate |
|---|---|
| PubChem CID | 10364176 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzenecarbothioate |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2SC(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C25H31NO2S/c1-19(2)15-18-25(16-9-4-10-17-25)24(28)26-21-13-7-8-14-22(21)29-23(27)20-11-5-3-6-12-20/h3,5-8,11-14,19H,4,9-10,15-18H2,1-2H3,(H,26,28) |
| InChIKey | PAUVZWIHHQXRET-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|