C27H33NO2S — CID 74007977
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 3-phenylprop-2-enethioate (PubChem CID 74007977) has the molecular formula C27H33NO2S and a molecular weight of 435.63 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 3-phenylprop-2-enethioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 3-phenylprop-2-enethioate |
|---|---|
| PubChem CID | 74007977 |
| Molecular Formula | C27H33NO2S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 3-phenylprop-2-enethioate |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2SC(=O)C=Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C27H33NO2S/c1-21(2)17-20-27(18-9-4-10-19-27)26(30)28-23-13-7-8-14-24(23)31-25(29)16-15-22-11-5-3-6-12-22/h3,5-8,11-16,21H,4,9-10,17-20H2,1-2H3,(H,28,30) |
| InChIKey | IGMWLDJYZGZUBI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|