C23H28N2O2S — CID 22956213
S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] pyridine-3-carbothioate (PubChem CID 22956213) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] pyridine-3-carbothioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] pyridine-3-carbothioate |
|---|---|
| PubChem CID | 22956213 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] pyridine-3-carbothioate |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2SC(=O)c2cccnc2)CCCC1 |
| InChI | InChI=1S/C23H28N2O2S/c1-17(2)11-14-23(12-5-6-13-23)22(27)25-19-9-3-4-10-20(19)28-21(26)18-8-7-15-24-16-18/h3-4,7-10,15-17H,5-6,11-14H2,1-2H3,(H,25,27) |
| InChIKey | JRXLABVBRDETJI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|