C24H29Cl3N2O2S — CID 162334288
S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] pyridine-3-carbothioate;hydrochloride (PubChem CID 162334288) has the molecular formula C24H29Cl3N2O2S and a molecular weight of 515.93 g/mol. Its IUPAC name is S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] pyridine-3-carbothioate;hydrochloride.
| Compound Name | S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] pyridine-3-carbothioate;hydrochloride |
|---|---|
| PubChem CID | 162334288 |
| Molecular Formula | C24H29Cl3N2O2S |
| Molecular Weight | 515.93 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] pyridine-3-carbothioate;hydrochloride |
| SMILES | CC(C)CCC1(C(=O)Nc2cc(Cl)c(Cl)cc2SC(=O)c2cccnc2)CCCCC1.Cl |
| InChI | InChI=1S/C24H28Cl2N2O2S.ClH/c1-16(2)8-11-24(9-4-3-5-10-24)23(30)28-20-13-18(25)19(26)14-21(20)31-22(29)17-7-6-12-27-15-17;/h6-7,12-16H,3-5,8-11H2,1-2H3,(H,28,30);1H |
| InChIKey | ZWETXSKDCSTTOV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.93 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|