C25H36Cl2N2O2S — CID 22956330
S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate (PubChem CID 22956330) has the molecular formula C25H36Cl2N2O2S and a molecular weight of 499.55 g/mol. Its IUPAC name is S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate.
| Compound Name | S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate |
|---|---|
| PubChem CID | 22956330 |
| Molecular Formula | C25H36Cl2N2O2S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate |
| SMILES | CC(C)CCC1(C(=O)Nc2cc(Cl)c(Cl)cc2SC(=O)C2CCN(C)CC2)CCCCC1 |
| InChI | InChI=1S/C25H36Cl2N2O2S/c1-17(2)7-12-25(10-5-4-6-11-25)24(31)28-21-15-19(26)20(27)16-22(21)32-23(30)18-8-13-29(3)14-9-18/h15-18H,4-14H2,1-3H3,(H,28,31) |
| InChIKey | GCTPNKLGAYTVMP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|