C21H29Cl2NO2S — CID 22956361
S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] propanethioate (PubChem CID 22956361) has the molecular formula C21H29Cl2NO2S and a molecular weight of 430.44 g/mol. Its IUPAC name is S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] propanethioate.
| Compound Name | S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] propanethioate |
|---|---|
| PubChem CID | 22956361 |
| Molecular Formula | C21H29Cl2NO2S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | S-[4,5-dichloro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] propanethioate |
| SMILES | CCC(=O)Sc1cc(Cl)c(Cl)cc1NC(=O)C1(CCC(C)C)CCCCC1 |
| InChI | InChI=1S/C21H29Cl2NO2S/c1-4-19(25)27-18-13-16(23)15(22)12-17(18)24-20(26)21(11-8-14(2)3)9-6-5-7-10-21/h12-14H,4-11H2,1-3H3,(H,24,26) |
| InChIKey | RJUMMVVPFAXVTE-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|