C27H35NO2S — CID 22956297
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,6-dimethylbenzenecarbothioate (PubChem CID 22956297) has the molecular formula C27H35NO2S and a molecular weight of 437.65 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,6-dimethylbenzenecarbothioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,6-dimethylbenzenecarbothioate |
|---|---|
| PubChem CID | 22956297 |
| Molecular Formula | C27H35NO2S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,6-dimethylbenzenecarbothioate |
| SMILES | Cc1cccc(C)c1C(=O)Sc1ccccc1NC(=O)C1(CCC(C)C)CCCCC1 |
| InChI | InChI=1S/C27H35NO2S/c1-19(2)15-18-27(16-8-5-9-17-27)26(30)28-22-13-6-7-14-23(22)31-25(29)24-20(3)11-10-12-21(24)4/h6-7,10-14,19H,5,8-9,15-18H2,1-4H3,(H,28,30) |
| InChIKey | CZFWBBYXENKYTK-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|