C23H34FNO2S — CID 150398128
S-[3-fluoro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,2-dimethylpropanethioate (PubChem CID 150398128) has the molecular formula C23H34FNO2S and a molecular weight of 407.60 g/mol. Its IUPAC name is S-[3-fluoro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[3-fluoro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 150398128 |
| Molecular Formula | C23H34FNO2S |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | S-[3-fluoro-2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)CCC1(C(=O)Nc2c(F)cccc2SC(=O)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C23H34FNO2S/c1-16(2)12-15-23(13-7-6-8-14-23)20(26)25-19-17(24)10-9-11-18(19)28-21(27)22(3,4)5/h9-11,16H,6-8,12-15H2,1-5H3,(H,25,26) |
| InChIKey | HDEHTVOHDXRGLV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|