C29H38N2O3S — CID 59902913
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] (2S)-2-acetamido-3-phenylpropanethioate (PubChem CID 59902913) has the molecular formula C29H38N2O3S and a molecular weight of 494.70 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] (2S)-2-acetamido-3-phenylpropanethioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] (2S)-2-acetamido-3-phenylpropanethioate |
|---|---|
| PubChem CID | 59902913 |
| Molecular Formula | C29H38N2O3S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] (2S)-2-acetamido-3-phenylpropanethioate |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)Sc1ccccc1NC(=O)C1(CCC(C)C)CCCCC1 |
| InChI | InChI=1S/C29H38N2O3S/c1-21(2)16-19-29(17-10-5-11-18-29)28(34)31-24-14-8-9-15-26(24)35-27(33)25(30-22(3)32)20-23-12-6-4-7-13-23/h4,6-9,12-15,21,25H,5,10-11,16-20H2,1-3H3,(H,30,32)(H,31,34)/t25-/m0/s1 |
| InChIKey | HYSIQIZWVLUQLT-VWLOTQADSA-N |
| XLogP | 6.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|