C24H37NO2S — CID 59067092
S-[2-[[1-(2-ethyl-3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-methylpropanethioate (PubChem CID 59067092) has the molecular formula C24H37NO2S and a molecular weight of 403.63 g/mol. Its IUPAC name is S-[2-[[1-(2-ethyl-3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-methylpropanethioate.
| Compound Name | S-[2-[[1-(2-ethyl-3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 59067092 |
| Molecular Formula | C24H37NO2S |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | S-[2-[[1-(2-ethyl-3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-methylpropanethioate |
| SMILES | CCC(CC1(C(=O)Nc2ccccc2SC(=O)C(C)C)CCCCC1)C(C)C |
| InChI | InChI=1S/C24H37NO2S/c1-6-19(17(2)3)16-24(14-10-7-11-15-24)23(27)25-20-12-8-9-13-21(20)28-22(26)18(4)5/h8-9,12-13,17-19H,6-7,10-11,14-16H2,1-5H3,(H,25,27) |
| InChIKey | VAGZZHSZILFSHM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|