C22H35NOS — CID 151208257
S-[2-[[1-(2-ethylbutyl)cyclohexyl]amino]phenyl] 2-methylpropanethioate (PubChem CID 151208257) has the molecular formula C22H35NOS and a molecular weight of 361.60 g/mol. Its IUPAC name is S-[2-[[1-(2-ethylbutyl)cyclohexyl]amino]phenyl] 2-methylpropanethioate.
| Compound Name | S-[2-[[1-(2-ethylbutyl)cyclohexyl]amino]phenyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 151208257 |
| Molecular Formula | C22H35NOS |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | S-[2-[[1-(2-ethylbutyl)cyclohexyl]amino]phenyl] 2-methylpropanethioate |
| SMILES | CCC(CC)CC1(Nc2ccccc2SC(=O)C(C)C)CCCCC1 |
| InChI | InChI=1S/C22H35NOS/c1-5-18(6-2)16-22(14-10-7-11-15-22)23-19-12-8-9-13-20(19)25-21(24)17(3)4/h8-9,12-13,17-18,23H,5-7,10-11,14-16H2,1-4H3 |
| InChIKey | NJSVTPAILVYBAS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|