C26H37NO2S — CID 162474084
S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohex-2-ene-1-carbothioate (PubChem CID 162474084) has the molecular formula C26H37NO2S and a molecular weight of 427.65 g/mol. Its IUPAC name is S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohex-2-ene-1-carbothioate.
| Compound Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohex-2-ene-1-carbothioate |
|---|---|
| PubChem CID | 162474084 |
| Molecular Formula | C26H37NO2S |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohex-2-ene-1-carbothioate |
| SMILES | CCC(CC)CC1(C(=O)Nc2ccccc2SC(=O)C2C=CCCC2)CCCCC1 |
| InChI | InChI=1S/C26H37NO2S/c1-3-20(4-2)19-26(17-11-6-12-18-26)25(29)27-22-15-9-10-16-23(22)30-24(28)21-13-7-5-8-14-21/h7,9-10,13,15-16,20-21H,3-6,8,11-12,14,17-19H2,1-2H3,(H,27,29) |
| InChIKey | LVFYCKFFBLZDHM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|