C20H29NO2S — CID 142965894
S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] methanethioate (PubChem CID 142965894) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] methanethioate.
| Compound Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] methanethioate |
|---|---|
| PubChem CID | 142965894 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] methanethioate |
| SMILES | CCC(CC)CC1(C(=O)Nc2ccccc2SC=O)CCCCC1 |
| InChI | InChI=1S/C20H29NO2S/c1-3-16(4-2)14-20(12-8-5-9-13-20)19(23)21-17-10-6-7-11-18(17)24-15-22/h6-7,10-11,15-16H,3-5,8-9,12-14H2,1-2H3,(H,21,23) |
| InChIKey | ZNYMJFLYRNYTBD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|