C27H39NO2S — CID 162474079
S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohept-4-ene-1-carbothioate (PubChem CID 162474079) has the molecular formula C27H39NO2S and a molecular weight of 441.68 g/mol. Its IUPAC name is S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohept-4-ene-1-carbothioate.
| Compound Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohept-4-ene-1-carbothioate |
|---|---|
| PubChem CID | 162474079 |
| Molecular Formula | C27H39NO2S |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] cyclohept-4-ene-1-carbothioate |
| SMILES | CCC(CC)CC1(C(=O)Nc2ccccc2SC(=O)C2CCC=CCC2)CCCCC1 |
| InChI | InChI=1S/C27H39NO2S/c1-3-21(4-2)20-27(18-12-7-13-19-27)26(30)28-23-16-10-11-17-24(23)31-25(29)22-14-8-5-6-9-15-22/h5-6,10-11,16-17,21-22H,3-4,7-9,12-15,18-20H2,1-2H3,(H,28,30) |
| InChIKey | BQOSNAWJMHWAAC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|