C28H40N2O6S — CID 162312897
(E)-but-2-enedioic acid;S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate (PubChem CID 162312897) has the molecular formula C28H40N2O6S and a molecular weight of 532.70 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate.
| Compound Name | (E)-but-2-enedioic acid;S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate |
|---|---|
| PubChem CID | 162312897 |
| Molecular Formula | C28H40N2O6S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (E)-but-2-enedioic acid;S-[2-[[1-(3-methylbutyl)cyclopentanecarbonyl]amino]phenyl] 1-methylpiperidine-4-carbothioate |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2SC(=O)C2CCN(C)CC2)CCCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H36N2O2S.C4H4O4/c1-18(2)10-15-24(13-6-7-14-24)23(28)25-20-8-4-5-9-21(20)29-22(27)19-11-16-26(3)17-12-19;5-3(6)1-2-4(7)8/h4-5,8-9,18-19H,6-7,10-17H2,1-3H3,(H,25,28);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AHCZAPQABOYMBQ-WLHGVMLRSA-N |
| XLogP | 5.29 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|