C24H36N2O3S — CID 20736345
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate (PubChem CID 20736345) has the molecular formula C24H36N2O3S and a molecular weight of 432.63 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate |
|---|---|
| PubChem CID | 20736345 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate |
| SMILES | CCC(NC(C)=O)C(=O)Sc1ccccc1NC(=O)C1(CCC(C)C)CCCCC1 |
| InChI | InChI=1S/C24H36N2O3S/c1-5-19(25-18(4)27)22(28)30-21-12-8-7-11-20(21)26-23(29)24(16-13-17(2)3)14-9-6-10-15-24/h7-8,11-12,17,19H,5-6,9-10,13-16H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | XIUVYCBGLAVKQN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|