About S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate (PubChem CID 20736345) has the molecular formula C24H36N2O3S
and a molecular weight of 432.63 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate.
Molecular Properties
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate |
| PubChem CID | 20736345 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate |
| SMILES | CCC(NC(C)=O)C(=O)Sc1ccccc1NC(=O)C1(CCC(C)C)CCCCC1 |
| InChI | InChI=1S/C24H36N2O3S/c1-5-19(25-18(4)27)22(28)30-21-12-8-7-11-20(21)26-23(29)24(16-13-17(2)3)14-9-6-10-15-24/h7-8,11-12,17,19H,5-6,9-10,13-16H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | XIUVYCBGLAVKQN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate?
The IUPAC name of S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate (CID 20736345) is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate.
What is the SMILES notation for S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate?
The canonical SMILES for S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate is CCC(NC(C)=O)C(=O)Sc1ccccc1NC(=O)C1(CCC(C)C)CCCCC1.
What is the InChIKey of S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate?
The InChIKey is XIUVYCBGLAVKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36N2O3S/c1-5-19(25-18(4)27)22(28)30-21-12-8-7-11-20(21)26-23(29)24(16-13-17(2)3)14-9-6-10-15-24/h7-8,11-12,17,19H,5-6,9-10,13-16H2,1-4H3,(H,25,27)(H,26,29).
What are the key properties of S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate?
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate has a molecular weight of 432.63 g/mol, XLogP of 5.55, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-acetamidobutanethioate is sourced from PubChem (CID 20736345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).