C26H33NO2S — CID 157229739
S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-phenylethanethioate (PubChem CID 157229739) has the molecular formula C26H33NO2S and a molecular weight of 423.62 g/mol. Its IUPAC name is S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-phenylethanethioate.
| Compound Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-phenylethanethioate |
|---|---|
| PubChem CID | 157229739 |
| Molecular Formula | C26H33NO2S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | S-[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] 2-phenylethanethioate |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2SC(=O)Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C26H33NO2S/c1-20(2)15-18-26(16-9-4-10-17-26)25(29)27-22-13-7-8-14-23(22)30-24(28)19-21-11-5-3-6-12-21/h3,5-8,11-14,20H,4,9-10,15-19H2,1-2H3,(H,27,29) |
| InChIKey | ATYPYYYLJMIQMJ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|