C22H26N2O2S — CID 88968594
S-[4-amino-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-phenylethanethioate (PubChem CID 88968594) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is S-[4-amino-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-phenylethanethioate.
| Compound Name | S-[4-amino-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-phenylethanethioate |
|---|---|
| PubChem CID | 88968594 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | S-[4-amino-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-phenylethanethioate |
| SMILES | CC1(C(=O)Nc2cc(N)ccc2SC(=O)Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H26N2O2S/c1-22(12-6-3-7-13-22)21(26)24-18-15-17(23)10-11-19(18)27-20(25)14-16-8-4-2-5-9-16/h2,4-5,8-11,15H,3,6-7,12-14,23H2,1H3,(H,24,26) |
| InChIKey | GMPBJZWCCXNWQQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|