C22H25NO2S2 — CID 89417733
1-methyl-N-(5-methyl-2-phenylsulfanylcarbonylsulfanylphenyl)cyclohexane-1-carboxamide (PubChem CID 89417733) has the molecular formula C22H25NO2S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 1-methyl-N-(5-methyl-2-phenylsulfanylcarbonylsulfanylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-methyl-N-(5-methyl-2-phenylsulfanylcarbonylsulfanylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 89417733 |
| Molecular Formula | C22H25NO2S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-methyl-N-(5-methyl-2-phenylsulfanylcarbonylsulfanylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(SC(=O)Sc2ccccc2)c(NC(=O)C2(C)CCCCC2)c1 |
| InChI | InChI=1S/C22H25NO2S2/c1-16-11-12-19(27-21(25)26-17-9-5-3-6-10-17)18(15-16)23-20(24)22(2)13-7-4-8-14-22/h3,5-6,9-12,15H,4,7-8,13-14H2,1-2H3,(H,23,24) |
| InChIKey | MGWFMXHUQSJFBH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|