C23H27Cl3N2O2S — CID 162328297
S-[4,5-dichloro-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] (2S)-2-amino-3-phenylpropanethioate;hydrochloride (PubChem CID 162328297) has the molecular formula C23H27Cl3N2O2S and a molecular weight of 501.91 g/mol. Its IUPAC name is S-[4,5-dichloro-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] (2S)-2-amino-3-phenylpropanethioate;hydrochloride.
| Compound Name | S-[4,5-dichloro-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] (2S)-2-amino-3-phenylpropanethioate;hydrochloride |
|---|---|
| PubChem CID | 162328297 |
| Molecular Formula | C23H27Cl3N2O2S |
| Molecular Weight | 501.91 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | S-[4,5-dichloro-2-[(1-methylcyclohexanecarbonyl)amino]phenyl] (2S)-2-amino-3-phenylpropanethioate;hydrochloride |
| SMILES | CC1(C(=O)Nc2cc(Cl)c(Cl)cc2SC(=O)[C@@H](N)Cc2ccccc2)CCCCC1.Cl |
| InChI | InChI=1S/C23H26Cl2N2O2S.ClH/c1-23(10-6-3-7-11-23)22(29)27-19-13-16(24)17(25)14-20(19)30-21(28)18(26)12-15-8-4-2-5-9-15;/h2,4-5,8-9,13-14,18H,3,6-7,10-12,26H2,1H3,(H,27,29);1H/t18-;/m0./s1 |
| InChIKey | XJQNRJJBPDZKDR-FERBBOLQSA-N |
| XLogP | 6.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.91 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|