C20H23NO2S2 — CID 22956225
S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-thiophen-2-ylethanethioate (PubChem CID 22956225) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-thiophen-2-ylethanethioate.
| Compound Name | S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-thiophen-2-ylethanethioate |
|---|---|
| PubChem CID | 22956225 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | S-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl] 2-thiophen-2-ylethanethioate |
| SMILES | CC1(C(=O)Nc2ccccc2SC(=O)Cc2cccs2)CCCCC1 |
| InChI | InChI=1S/C20H23NO2S2/c1-20(11-5-2-6-12-20)19(23)21-16-9-3-4-10-17(16)25-18(22)14-15-8-7-13-24-15/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3,(H,21,23) |
| InChIKey | WKHDYZYOFQXIET-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|