C27H34N2O3S — CID 22956271
S-[2-(2,2-dimethylpropanoylamino)phenyl] 2-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl]ethanethioate (PubChem CID 22956271) has the molecular formula C27H34N2O3S and a molecular weight of 466.65 g/mol. Its IUPAC name is S-[2-(2,2-dimethylpropanoylamino)phenyl] 2-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl]ethanethioate.
| Compound Name | S-[2-(2,2-dimethylpropanoylamino)phenyl] 2-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl]ethanethioate |
|---|---|
| PubChem CID | 22956271 |
| Molecular Formula | C27H34N2O3S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | S-[2-(2,2-dimethylpropanoylamino)phenyl] 2-[2-[(1-methylcyclohexanecarbonyl)amino]phenyl]ethanethioate |
| SMILES | CC(C)(C)C(=O)Nc1ccccc1SC(=O)Cc1ccccc1NC(=O)C1(C)CCCCC1 |
| InChI | InChI=1S/C27H34N2O3S/c1-26(2,3)24(31)29-21-14-8-9-15-22(21)33-23(30)18-19-12-6-7-13-20(19)28-25(32)27(4)16-10-5-11-17-27/h6-9,12-15H,5,10-11,16-18H2,1-4H3,(H,28,32)(H,29,31) |
| InChIKey | KRPXFHDDRALBBS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|