C25H39NO2S — CID 25059994
S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] hexanethioate (PubChem CID 25059994) has the molecular formula C25H39NO2S and a molecular weight of 417.66 g/mol. Its IUPAC name is S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] hexanethioate.
| Compound Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] hexanethioate |
|---|---|
| PubChem CID | 25059994 |
| Molecular Formula | C25H39NO2S |
| Molecular Weight | 417.66 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | S-[2-[[1-(2-ethylbutyl)cyclohexanecarbonyl]amino]phenyl] hexanethioate |
| SMILES | CCCCCC(=O)Sc1ccccc1NC(=O)C1(CC(CC)CC)CCCCC1 |
| InChI | InChI=1S/C25H39NO2S/c1-4-7-9-16-23(27)29-22-15-11-10-14-21(22)26-24(28)25(17-12-8-13-18-25)19-20(5-2)6-3/h10-11,14-15,20H,4-9,12-13,16-19H2,1-3H3,(H,26,28) |
| InChIKey | XIYLKZMMKDWXQB-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.66 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|