C44H56N2O4S2 — CID 22956204
1-S,4-S-bis[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzene-1,4-dicarbothioate (PubChem CID 22956204) has the molecular formula C44H56N2O4S2 and a molecular weight of 741.08 g/mol. Its IUPAC name is 1-S,4-S-bis[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzene-1,4-dicarbothioate.
| Compound Name | 1-S,4-S-bis[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzene-1,4-dicarbothioate |
|---|---|
| PubChem CID | 22956204 |
| Molecular Formula | C44H56N2O4S2 |
| Molecular Weight | 741.08 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | 1-S,4-S-bis[2-[[1-(3-methylbutyl)cyclohexanecarbonyl]amino]phenyl] benzene-1,4-dicarbothioate |
| SMILES | CC(C)CCC1(C(=O)Nc2ccccc2SC(=O)c2ccc(C(=O)Sc3ccccc3NC(=O)C3(CCC(C)C)CCCCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C44H56N2O4S2/c1-31(2)23-29-43(25-11-5-12-26-43)41(49)45-35-15-7-9-17-37(35)51-39(47)33-19-21-34(22-20-33)40(48)52-38-18-10-8-16-36(38)46-42(50)44(30-24-32(3)4)27-13-6-14-28-44/h7-10,15-22,31-32H,5-6,11-14,23-30H2,1-4H3,(H,45,49)(H,46,50) |
| InChIKey | VRNNFUYDRXWGBK-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.08 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|