C26H36O5 — CID 134372075
[(1R,2R,6R,8R,13S,14S,17S)-4,4,9,9-tetramethyl-18,19-dimethylidene-15-oxo-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecan-13-yl]methyl acetate (PubChem CID 134372075) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(1R,2R,6R,8R,13S,14S,17S)-4,4,9,9-tetramethyl-18,19-dimethylidene-15-oxo-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecan-13-yl]methyl acetate.
| Compound Name | [(1R,2R,6R,8R,13S,14S,17S)-4,4,9,9-tetramethyl-18,19-dimethylidene-15-oxo-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecan-13-yl]methyl acetate |
|---|---|
| PubChem CID | 134372075 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(1R,2R,6R,8R,13S,14S,17S)-4,4,9,9-tetramethyl-18,19-dimethylidene-15-oxo-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecan-13-yl]methyl acetate |
| SMILES | C=C1C(=C)[C@@]23[C@@H]4OC(C)(C)O[C@@H]2C[C@@H]2C(C)(C)CCC[C@@]2(COC(C)=O)[C@@H]3C(=O)C[C@@H]14 |
| InChI | InChI=1S/C26H36O5/c1-14-15(2)26-20-12-19-23(4,5)9-8-10-25(19,13-29-16(3)27)21(26)18(28)11-17(14)22(26)31-24(6,7)30-20/h17,19-22H,1-2,8-13H2,3-7H3/t17-,19+,20+,21-,22+,25-,26+/m0/s1 |
| InChIKey | NZQAJPFODKFTDE-CAPIZUEHSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |