C26H38O5 — CID 44631457
(1R,2S,5S,8R,9R,13R,15R,18R,22R)-1,11,11,16,16,20,20-heptamethyl-6-methylidene-10,12,19,21-tetraoxahexacyclo[13.7.0.02,8.05,9.08,13.018,22]docosan-7-one (PubChem CID 44631457) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (1R,2S,5S,8R,9R,13R,15R,18R,22R)-1,11,11,16,16,20,20-heptamethyl-6-methylidene-10,12,19,21-tetraoxahexacyclo[13.7.0.02,8.05,9.08,13.018,22]docosan-7-one.
| Compound Name | (1R,2S,5S,8R,9R,13R,15R,18R,22R)-1,11,11,16,16,20,20-heptamethyl-6-methylidene-10,12,19,21-tetraoxahexacyclo[13.7.0.02,8.05,9.08,13.018,22]docosan-7-one |
|---|---|
| PubChem CID | 44631457 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (1R,2S,5S,8R,9R,13R,15R,18R,22R)-1,11,11,16,16,20,20-heptamethyl-6-methylidene-10,12,19,21-tetraoxahexacyclo[13.7.0.02,8.05,9.08,13.018,22]docosan-7-one |
| SMILES | C=C1C(=O)[C@@]23[C@@H]4OC(C)(C)O[C@@H]2C[C@@H]2C(C)(C)C[C@H]5OC(C)(C)O[C@@H]5[C@@]2(C)[C@@H]3CC[C@@H]14 |
| InChI | InChI=1S/C26H38O5/c1-13-14-9-10-16-25(8)17(22(2,3)12-15-21(25)31-23(4,5)28-15)11-18-26(16,19(13)27)20(14)30-24(6,7)29-18/h14-18,20-21H,1,9-12H2,2-8H3/t14-,15+,16-,17+,18+,20+,21-,25-,26-/m0/s1 |
| InChIKey | GGBLYIRPRQUMJE-OPUXHWHESA-N |
| XLogP | 4.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|