C24H28O7 — CID 129024391
(1S,2S,5S,9R,14S,15R)-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-7,19-dioxo-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-18-carbaldehyde (PubChem CID 129024391) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is (1S,2S,5S,9R,14S,15R)-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-7,19-dioxo-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-18-carbaldehyde.
| Compound Name | (1S,2S,5S,9R,14S,15R)-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-7,19-dioxo-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-18-carbaldehyde |
|---|---|
| PubChem CID | 129024391 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (1S,2S,5S,9R,14S,15R)-14-hydroxy-11,11,16,16-tetramethyl-6-methylidene-7,19-dioxo-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-18-carbaldehyde |
| SMILES | C=C1C(=O)C23C4CC[C@@H]1[C@H]2OC(C)(C)OC31OC[C@]42C(=O)C(C=O)=CC(C)(C)[C@H]2C1O |
| InChI | InChI=1S/C24H28O7/c1-11-13-6-7-14-22-10-29-24(23(14,16(11)26)19(13)30-21(4,5)31-24)18(28)15(22)20(2,3)8-12(9-25)17(22)27/h8-9,13-15,18-19,28H,1,6-7,10H2,2-5H3/t13-,14?,15+,18?,19+,22-,23?,24?/m0/s1 |
| InChIKey | HPUOGVCKEJYHNB-CEVLEOBFSA-N |
| XLogP | 1.73 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|