C23H36O5 — CID 56926395
(1R,5S,8R,13R,14S)-6-(hydroxymethyl)-11,11,16,16-tetramethyl-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicosan-14-ol (PubChem CID 56926395) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (1R,5S,8R,13R,14S)-6-(hydroxymethyl)-11,11,16,16-tetramethyl-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicosan-14-ol.
| Compound Name | (1R,5S,8R,13R,14S)-6-(hydroxymethyl)-11,11,16,16-tetramethyl-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicosan-14-ol |
|---|---|
| PubChem CID | 56926395 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (1R,5S,8R,13R,14S)-6-(hydroxymethyl)-11,11,16,16-tetramethyl-10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicosan-14-ol |
| SMILES | CC1(C)OC2[C@H]3CCC4[C@]56CCCC(C)(C)C5[C@H](O)[C@](OC6)(O1)[C@@]24CC3CO |
| InChI | InChI=1S/C23H36O5/c1-19(2)8-5-9-21-12-26-23(17(25)16(19)21)22-10-13(11-24)14(6-7-15(21)22)18(22)27-20(3,4)28-23/h13-18,24-25H,5-12H2,1-4H3/t13?,14-,15?,16?,17-,18?,21+,22+,23-/m0/s1 |
| InChIKey | SHXBIPIIEMNALE-ZBQPMGQASA-N |
| XLogP | 3.08 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |