C31H46O8 — CID 123572479
14-hydroxy-21-(4-hydroxybutoxy)-6,6,11,11,16,16-hexamethyl-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one (PubChem CID 123572479) has the molecular formula C31H46O8 and a molecular weight of 546.70 g/mol. Its IUPAC name is 14-hydroxy-21-(4-hydroxybutoxy)-6,6,11,11,16,16-hexamethyl-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one.
| Compound Name | 14-hydroxy-21-(4-hydroxybutoxy)-6,6,11,11,16,16-hexamethyl-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one |
|---|---|
| PubChem CID | 123572479 |
| Molecular Formula | C31H46O8 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 14-hydroxy-21-(4-hydroxybutoxy)-6,6,11,11,16,16-hexamethyl-10,12,22,25-tetraoxaheptacyclo[11.10.2.01,15.02,8.05,9.08,13.018,23]pentacos-18(23)-en-7-one |
| SMILES | CC1(C)OC2C3CCC4C56COC(O1)(C(O)C5C(C)(C)CC1=C6OC(OCCCCO)CC1)C24C(=O)C3(C)C |
| InChI | InChI=1S/C31H46O8/c1-26(2)15-17-9-12-20(35-14-8-7-13-32)37-23(17)29-16-36-31(22(33)21(26)29)30-19(29)11-10-18(27(3,4)25(30)34)24(30)38-28(5,6)39-31/h18-22,24,32-33H,7-16H2,1-6H3 |
| InChIKey | HPQKEOWAOJSQBQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|