C23H29NO6 — CID 121262669
(1S,5S,8R,9R,14S)-14-hydroxy-11,11,16,16-tetramethylspiro[10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-6,2'-aziridine]-7,19-dione (PubChem CID 121262669) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is (1S,5S,8R,9R,14S)-14-hydroxy-11,11,16,16-tetramethylspiro[10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-6,2'-aziridine]-7,19-dione.
| Compound Name | (1S,5S,8R,9R,14S)-14-hydroxy-11,11,16,16-tetramethylspiro[10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-6,2'-aziridine]-7,19-dione |
|---|---|
| PubChem CID | 121262669 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (1S,5S,8R,9R,14S)-14-hydroxy-11,11,16,16-tetramethylspiro[10,12,21-trioxahexacyclo[11.6.2.01,15.02,8.05,9.08,13]henicos-17-ene-6,2'-aziridine]-7,19-dione |
| SMILES | CC1(C)O[C@@H]2C3CCC4[C@@]56COC(O1)(C(O)C5C(C)(C)C=CC6=O)[C@]42C(=O)C31CN1 |
| InChI | InChI=1S/C23H29NO6/c1-18(2)8-7-13(25)20-10-28-23(15(26)14(18)20)22-12(20)6-5-11(21(9-24-21)17(22)27)16(22)29-19(3,4)30-23/h7-8,11-12,14-16,24,26H,5-6,9-10H2,1-4H3/t11?,12?,14?,15?,16-,20-,21?,22-,23?/m1/s1 |
| InChIKey | FWSUQAUCTBLFGX-XHUUOSHJSA-N |
| XLogP | 0.94 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|