C23H32O6 — CID 130307582
(1S,2S,5S,6R,7R,8R,9S,10R,11R)-7-acetyl-11-ethyl-6,8,9-trihydroxy-11-methyl-5-prop-1-en-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadec-12-en-14-one (PubChem CID 130307582) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is (1S,2S,5S,6R,7R,8R,9S,10R,11R)-7-acetyl-11-ethyl-6,8,9-trihydroxy-11-methyl-5-prop-1-en-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadec-12-en-14-one.
| Compound Name | (1S,2S,5S,6R,7R,8R,9S,10R,11R)-7-acetyl-11-ethyl-6,8,9-trihydroxy-11-methyl-5-prop-1-en-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadec-12-en-14-one |
|---|---|
| PubChem CID | 130307582 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (1S,2S,5S,6R,7R,8R,9S,10R,11R)-7-acetyl-11-ethyl-6,8,9-trihydroxy-11-methyl-5-prop-1-en-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadec-12-en-14-one |
| SMILES | C=C(C)[C@@H]1CC[C@H]2[C@@]34CO[C@@](O)([C@@H](O)[C@@H]3[C@](C)(CC)C=CC4=O)[C@@]2(C(C)=O)[C@@H]1O |
| InChI | InChI=1S/C23H32O6/c1-6-20(5)10-9-16(25)21-11-29-23(28,19(27)17(20)21)22(13(4)24)15(21)8-7-14(12(2)3)18(22)26/h9-10,14-15,17-19,26-28H,2,6-8,11H2,1,3-5H3/t14-,15-,17+,18+,19-,20+,21+,22+,23-/m0/s1 |
| InChIKey | YKXUCCVAJNGNIS-LQZLJTOJSA-N |
| XLogP | 1.78 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|